C31H42Cl2N2O4 — CID 98516905
[(1S,3aS,3bS,5aR,10aR,10bS,12aR)-10a,12a-dimethyl-8-oxo-2,3,3a,3b,4,5,5a,6,7,10b,11,12-dodecahydro-1H-indeno[5,4-g][2]benzazepin-1-yl] 2-[4-[bis(2-chloroethyl)amino]phenoxy]acetate (PubChem CID 98516905) has the molecular formula C31H42Cl2N2O4 and a molecular weight of 577.59 g/mol. Its IUPAC name is [(1S,3aS,3bS,5aR,10aR,10bS,12aR)-10a,12a-dimethyl-8-oxo-2,3,3a,3b,4,5,5a,6,7,10b,11,12-dodecahydro-1H-indeno[5,4-g][2]benzazepin-1-yl] 2-[4-[bis(2-chloroethyl)amino]phenoxy]acetate.
| Compound Name | [(1S,3aS,3bS,5aR,10aR,10bS,12aR)-10a,12a-dimethyl-8-oxo-2,3,3a,3b,4,5,5a,6,7,10b,11,12-dodecahydro-1H-indeno[5,4-g][2]benzazepin-1-yl] 2-[4-[bis(2-chloroethyl)amino]phenoxy]acetate |
|---|---|
| PubChem CID | 98516905 |
| Molecular Formula | C31H42Cl2N2O4 |
| Molecular Weight | 577.59 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | [(1S,3aS,3bS,5aR,10aR,10bS,12aR)-10a,12a-dimethyl-8-oxo-2,3,3a,3b,4,5,5a,6,7,10b,11,12-dodecahydro-1H-indeno[5,4-g][2]benzazepin-1-yl] 2-[4-[bis(2-chloroethyl)amino]phenoxy]acetate |
| SMILES | C[C@]12C=CC(=O)NC[C@@H]1CC[C@H]1[C@@H]2CC[C@@]2(C)[C@@H](OC(=O)COc3ccc(N(CCCl)CCCl)cc3)CC[C@@H]12 |
| InChI | InChI=1S/C31H42Cl2N2O4/c1-30-14-12-28(36)34-19-21(30)3-8-24-25-9-10-27(31(25,2)13-11-26(24)30)39-29(37)20-38-23-6-4-22(5-7-23)35(17-15-32)18-16-33/h4-7,12,14,21,24-27H,3,8-11,13,15-20H2,1-2H3,(H,34,36)/t21-,24+,25-,26-,27-,30-,31+/m0/s1 |
| InChIKey | XACVDPCGRAMKST-VMXPHWOQSA-N |
| XLogP | 5.81 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.59 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|