C30H40Cl2N2O3 — CID 635610
(9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,6,8,9,9b,10,11-dodecahydroindeno[5,4-f]quinolin-1-yl) 2-[4-[bis(2-chloroethyl)amino]phenyl]acetate (PubChem CID 635610) has the molecular formula C30H40Cl2N2O3 and a molecular weight of 547.57 g/mol. Its IUPAC name is (9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,6,8,9,9b,10,11-dodecahydroindeno[5,4-f]quinolin-1-yl) 2-[4-[bis(2-chloroethyl)amino]phenyl]acetate.
| Compound Name | (9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,6,8,9,9b,10,11-dodecahydroindeno[5,4-f]quinolin-1-yl) 2-[4-[bis(2-chloroethyl)amino]phenyl]acetate |
|---|---|
| PubChem CID | 635610 |
| Molecular Formula | C30H40Cl2N2O3 |
| Molecular Weight | 547.57 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | (9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,6,8,9,9b,10,11-dodecahydroindeno[5,4-f]quinolin-1-yl) 2-[4-[bis(2-chloroethyl)amino]phenyl]acetate |
| SMILES | CC12CCC(=O)NC1=CCC1C2CCC2(C)C(OC(=O)Cc3ccc(N(CCCl)CCCl)cc3)CCC12 |
| InChI | InChI=1S/C30H40Cl2N2O3/c1-29-14-12-27(35)33-25(29)9-7-22-23-8-10-26(30(23,2)13-11-24(22)29)37-28(36)19-20-3-5-21(6-4-20)34(17-15-31)18-16-32/h3-6,9,22-24,26H,7-8,10-19H2,1-2H3,(H,33,35) |
| InChIKey | CTTZEKNSIWKPOQ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.57 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|