C33H45Cl2N3O4 — CID 44576363
[(1R,2R,5S,11R,12R,15S,16S)-15-acetamido-2,16-dimethyl-9-oxo-10-azatetracyclo[9.7.0.02,7.012,16]octadec-7-en-5-yl] 2-[4-[bis(2-chloroethyl)amino]phenyl]acetate (PubChem CID 44576363) has the molecular formula C33H45Cl2N3O4 and a molecular weight of 618.65 g/mol. Its IUPAC name is [(1R,2R,5S,11R,12R,15S,16S)-15-acetamido-2,16-dimethyl-9-oxo-10-azatetracyclo[9.7.0.02,7.012,16]octadec-7-en-5-yl] 2-[4-[bis(2-chloroethyl)amino]phenyl]acetate.
| Compound Name | [(1R,2R,5S,11R,12R,15S,16S)-15-acetamido-2,16-dimethyl-9-oxo-10-azatetracyclo[9.7.0.02,7.012,16]octadec-7-en-5-yl] 2-[4-[bis(2-chloroethyl)amino]phenyl]acetate |
|---|---|
| PubChem CID | 44576363 |
| Molecular Formula | C33H45Cl2N3O4 |
| Molecular Weight | 618.65 g/mol |
| Exact Mass | 617.28 |
| IUPAC Name | [(1R,2R,5S,11R,12R,15S,16S)-15-acetamido-2,16-dimethyl-9-oxo-10-azatetracyclo[9.7.0.02,7.012,16]octadec-7-en-5-yl] 2-[4-[bis(2-chloroethyl)amino]phenyl]acetate |
| SMILES | CC(=O)N[C@H]1CC[C@H]2[C@@H]3NC(=O)C=C4C[C@@H](OC(=O)Cc5ccc(N(CCCl)CCCl)cc5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C33H45Cl2N3O4/c1-21(39)36-28-9-8-26-31-27(11-13-33(26,28)3)32(2)12-10-25(19-23(32)20-29(40)37-31)42-30(41)18-22-4-6-24(7-5-22)38(16-14-34)17-15-35/h4-7,20,25-28,31H,8-19H2,1-3H3,(H,36,39)(H,37,40)/t25-,26-,27-,28-,31-,32-,33-/m0/s1 |
| InChIKey | YOZRWVBLMLOWJE-JIZWCSCZSA-N |
| XLogP | 5.37 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.65 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|