C20H30N2O3 — CID 145221601
(1R,2R,12S,17S)-5-methoxy-2,17-dimethyl-10,16-diazatetracyclo[9.8.0.02,7.012,17]nonadec-7-ene-9,15-dione (PubChem CID 145221601) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is (1R,2R,12S,17S)-5-methoxy-2,17-dimethyl-10,16-diazatetracyclo[9.8.0.02,7.012,17]nonadec-7-ene-9,15-dione.
| Compound Name | (1R,2R,12S,17S)-5-methoxy-2,17-dimethyl-10,16-diazatetracyclo[9.8.0.02,7.012,17]nonadec-7-ene-9,15-dione |
|---|---|
| PubChem CID | 145221601 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | (1R,2R,12S,17S)-5-methoxy-2,17-dimethyl-10,16-diazatetracyclo[9.8.0.02,7.012,17]nonadec-7-ene-9,15-dione |
| SMILES | COC1CC[C@@]2(C)C(=CC(=O)NC3[C@@H]2CC[C@]2(C)NC(=O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C20H30N2O3/c1-19-8-6-13(25-3)10-12(19)11-17(24)21-18-14(19)7-9-20(2)15(18)4-5-16(23)22-20/h11,13-15,18H,4-10H2,1-3H3,(H,21,24)(H,22,23)/t13?,14-,15-,18?,19-,20-/m0/s1 |
| InChIKey | SQJCLAOXGUCCRF-VNAPPTDXSA-N |
| XLogP | 2.31 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |