C20H28O3 — CID 53230427
(4aS,4bR,8S,10aR,10bS,12aS)-8-methoxy-10a,12a-dimethyl-4a,4b,5,7,8,9,10,10b,11,12-decahydronaphtho[2,1-f]chromen-2-one (PubChem CID 53230427) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (4aS,4bR,8S,10aR,10bS,12aS)-8-methoxy-10a,12a-dimethyl-4a,4b,5,7,8,9,10,10b,11,12-decahydronaphtho[2,1-f]chromen-2-one.
| Compound Name | (4aS,4bR,8S,10aR,10bS,12aS)-8-methoxy-10a,12a-dimethyl-4a,4b,5,7,8,9,10,10b,11,12-decahydronaphtho[2,1-f]chromen-2-one |
|---|---|
| PubChem CID | 53230427 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (4aS,4bR,8S,10aR,10bS,12aS)-8-methoxy-10a,12a-dimethyl-4a,4b,5,7,8,9,10,10b,11,12-decahydronaphtho[2,1-f]chromen-2-one |
| SMILES | CO[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)OC(=O)C=C[C@@H]32)C1 |
| InChI | InChI=1S/C20H28O3/c1-19-10-8-14(22-3)12-13(19)4-5-15-16(19)9-11-20(2)17(15)6-7-18(21)23-20/h4,6-7,14-17H,5,8-12H2,1-3H3/t14-,15+,16-,17-,19-,20-/m0/s1 |
| InChIKey | UAJDFRMGGQSEHN-KCMORZRYSA-N |
| XLogP | 4.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|