C21H13Br2ClN2O5 — CID 134140579
[2,4-dibromo-6-[2-(3-nitroanilino)-2-oxoethyl]phenyl] 2-chlorobenzoate (PubChem CID 134140579) has the molecular formula C21H13Br2ClN2O5 and a molecular weight of 568.61 g/mol. Its IUPAC name is [2,4-dibromo-6-[2-(3-nitroanilino)-2-oxoethyl]phenyl] 2-chlorobenzoate.
| Compound Name | [2,4-dibromo-6-[2-(3-nitroanilino)-2-oxoethyl]phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 134140579 |
| Molecular Formula | C21H13Br2ClN2O5 |
| Molecular Weight | 568.61 g/mol |
| Exact Mass | 565.89 |
| IUPAC Name | [2,4-dibromo-6-[2-(3-nitroanilino)-2-oxoethyl]phenyl] 2-chlorobenzoate |
| SMILES | O=C(Cc1cc(Br)cc(Br)c1OC(=O)c1ccccc1Cl)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H13Br2ClN2O5/c22-13-8-12(9-19(27)25-14-4-3-5-15(11-14)26(29)30)20(17(23)10-13)31-21(28)16-6-1-2-7-18(16)24/h1-8,10-11H,9H2,(H,25,27) |
| InChIKey | OODSHSDOVLVKOV-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.61 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|