C21H14Br2N2O5 — CID 2237882
[2-(benzamidomethyl)-4,6-dibromophenyl] 3-nitrobenzoate (PubChem CID 2237882) has the molecular formula C21H14Br2N2O5 and a molecular weight of 534.16 g/mol. Its IUPAC name is [2-(benzamidomethyl)-4,6-dibromophenyl] 3-nitrobenzoate.
| Compound Name | [2-(benzamidomethyl)-4,6-dibromophenyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 2237882 |
| Molecular Formula | C21H14Br2N2O5 |
| Molecular Weight | 534.16 g/mol |
| Exact Mass | 531.93 |
| IUPAC Name | [2-(benzamidomethyl)-4,6-dibromophenyl] 3-nitrobenzoate |
| SMILES | O=C(NCc1cc(Br)cc(Br)c1OC(=O)c1cccc([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C21H14Br2N2O5/c22-16-9-15(12-24-20(26)13-5-2-1-3-6-13)19(18(23)11-16)30-21(27)14-7-4-8-17(10-14)25(28)29/h1-11H,12H2,(H,24,26) |
| InChIKey | MVHMQBYQUVONJG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.16 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|