C23H20ClN5O3 — CID 134141090
1-(2-chlorophenyl)-3-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]urea (PubChem CID 134141090) has the molecular formula C23H20ClN5O3 and a molecular weight of 449.90 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]urea |
|---|---|
| PubChem CID | 134141090 |
| Molecular Formula | C23H20ClN5O3 |
| Molecular Weight | 449.90 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]urea |
| SMILES | COc1cc(Nc2ncnc3c(NC(=O)Nc4ccccc4Cl)cccc23)cc(OC)c1 |
| InChI | InChI=1S/C23H20ClN5O3/c1-31-15-10-14(11-16(12-15)32-2)27-22-17-6-5-9-20(21(17)25-13-26-22)29-23(30)28-19-8-4-3-7-18(19)24/h3-13H,1-2H3,(H,25,26,27)(H2,28,29,30) |
| InChIKey | ZEQSEPWFIRUVLG-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.90 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |