C31H29N3O2 — CID 134143744
N-[3-[[3-[(E)-2-phenylethenyl]-1H-indazol-6-yl]oxy]phenyl]bicyclo[3.3.1]non-6-ene-3-carboxamide (PubChem CID 134143744) has the molecular formula C31H29N3O2 and a molecular weight of 475.59 g/mol. Its IUPAC name is N-[3-[[3-[(E)-2-phenylethenyl]-1H-indazol-6-yl]oxy]phenyl]bicyclo[3.3.1]non-6-ene-3-carboxamide.
| Compound Name | N-[3-[[3-[(E)-2-phenylethenyl]-1H-indazol-6-yl]oxy]phenyl]bicyclo[3.3.1]non-6-ene-3-carboxamide |
|---|---|
| PubChem CID | 134143744 |
| Molecular Formula | C31H29N3O2 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | N-[3-[[3-[(E)-2-phenylethenyl]-1H-indazol-6-yl]oxy]phenyl]bicyclo[3.3.1]non-6-ene-3-carboxamide |
| SMILES | O=C(Nc1cccc(Oc2ccc3c(/C=C/c4ccccc4)n[nH]c3c2)c1)C1CC2C=CCC(C2)C1 |
| InChI | InChI=1S/C31H29N3O2/c35-31(24-17-22-8-4-9-23(16-22)18-24)32-25-10-5-11-26(19-25)36-27-13-14-28-29(33-34-30(28)20-27)15-12-21-6-2-1-3-7-21/h1-8,10-15,19-20,22-24H,9,16-18H2,(H,32,35)(H,33,34)/b15-12+ |
| InChIKey | GDXPNULHKHHNBK-NTCAYCPXSA-N |
| XLogP | 7.46 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|