C30H26N4O3 — CID 134152211
(E)-N-(cyclopropylmethyl)-N'-[3-[3-[(E)-2-phenylethenyl]-1H-indazole-6-carbonyl]phenyl]but-2-enediamide (PubChem CID 134152211) has the molecular formula C30H26N4O3 and a molecular weight of 490.56 g/mol. Its IUPAC name is (E)-N-(cyclopropylmethyl)-N'-[3-[3-[(E)-2-phenylethenyl]-1H-indazole-6-carbonyl]phenyl]but-2-enediamide.
| Compound Name | (E)-N-(cyclopropylmethyl)-N'-[3-[3-[(E)-2-phenylethenyl]-1H-indazole-6-carbonyl]phenyl]but-2-enediamide |
|---|---|
| PubChem CID | 134152211 |
| Molecular Formula | C30H26N4O3 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | (E)-N-(cyclopropylmethyl)-N'-[3-[3-[(E)-2-phenylethenyl]-1H-indazole-6-carbonyl]phenyl]but-2-enediamide |
| SMILES | O=C(/C=C/C(=O)Nc1cccc(C(=O)c2ccc3c(/C=C/c4ccccc4)n[nH]c3c2)c1)NCC1CC1 |
| InChI | InChI=1S/C30H26N4O3/c35-28(31-19-21-9-10-21)15-16-29(36)32-24-8-4-7-22(17-24)30(37)23-12-13-25-26(33-34-27(25)18-23)14-11-20-5-2-1-3-6-20/h1-8,11-18,21H,9-10,19H2,(H,31,35)(H,32,36)(H,33,34)/b14-11+,16-15+ |
| InChIKey | WJOTXMHQKREUEX-LPVXAABHSA-N |
| XLogP | 4.99 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|