C23H19N3O — CID 142037641
[3-(methylamino)phenyl]-[3-[(E)-2-phenylethenyl]-1H-indazol-6-yl]methanone (PubChem CID 142037641) has the molecular formula C23H19N3O and a molecular weight of 353.43 g/mol. Its IUPAC name is [3-(methylamino)phenyl]-[3-[(E)-2-phenylethenyl]-1H-indazol-6-yl]methanone.
| Compound Name | [3-(methylamino)phenyl]-[3-[(E)-2-phenylethenyl]-1H-indazol-6-yl]methanone |
|---|---|
| PubChem CID | 142037641 |
| Molecular Formula | C23H19N3O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | [3-(methylamino)phenyl]-[3-[(E)-2-phenylethenyl]-1H-indazol-6-yl]methanone |
| SMILES | CNc1cccc(C(=O)c2ccc3c(/C=C/c4ccccc4)n[nH]c3c2)c1 |
| InChI | InChI=1S/C23H19N3O/c1-24-19-9-5-8-17(14-19)23(27)18-11-12-20-21(25-26-22(20)15-18)13-10-16-6-3-2-4-7-16/h2-15,24H,1H3,(H,25,26)/b13-10+ |
| InChIKey | QYSFHZDOHPTMJD-JLHYYAGUSA-N |
| XLogP | 5.01 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |