C33H29N3O2 — CID 134146773
2-(2-methylphenyl)-N-[3-[3-[(E)-2-phenylethenyl]-1H-indazole-6-carbonyl]phenyl]butanamide (PubChem CID 134146773) has the molecular formula C33H29N3O2 and a molecular weight of 499.61 g/mol. Its IUPAC name is 2-(2-methylphenyl)-N-[3-[3-[(E)-2-phenylethenyl]-1H-indazole-6-carbonyl]phenyl]butanamide.
| Compound Name | 2-(2-methylphenyl)-N-[3-[3-[(E)-2-phenylethenyl]-1H-indazole-6-carbonyl]phenyl]butanamide |
|---|---|
| PubChem CID | 134146773 |
| Molecular Formula | C33H29N3O2 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 2-(2-methylphenyl)-N-[3-[3-[(E)-2-phenylethenyl]-1H-indazole-6-carbonyl]phenyl]butanamide |
| SMILES | CCC(C(=O)Nc1cccc(C(=O)c2ccc3c(/C=C/c4ccccc4)n[nH]c3c2)c1)c1ccccc1C |
| InChI | InChI=1S/C33H29N3O2/c1-3-27(28-15-8-7-10-22(28)2)33(38)34-26-14-9-13-24(20-26)32(37)25-17-18-29-30(35-36-31(29)21-25)19-16-23-11-5-4-6-12-23/h4-21,27H,3H2,1-2H3,(H,34,38)(H,35,36)/b19-16+ |
| InChIKey | APHMBSRAFIBXLP-KNTRCKAVSA-N |
| XLogP | 7.41 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |