C25H22N4O — CID 70128556
[3-[[(E)-but-2-enyl]amino]phenyl]-[3-[(E)-2-pyridin-2-ylethenyl]-1H-indazol-6-yl]methanone (PubChem CID 70128556) has the molecular formula C25H22N4O and a molecular weight of 394.48 g/mol. Its IUPAC name is [3-[[(E)-but-2-enyl]amino]phenyl]-[3-[(E)-2-pyridin-2-ylethenyl]-1H-indazol-6-yl]methanone.
| Compound Name | [3-[[(E)-but-2-enyl]amino]phenyl]-[3-[(E)-2-pyridin-2-ylethenyl]-1H-indazol-6-yl]methanone |
|---|---|
| PubChem CID | 70128556 |
| Molecular Formula | C25H22N4O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | [3-[[(E)-but-2-enyl]amino]phenyl]-[3-[(E)-2-pyridin-2-ylethenyl]-1H-indazol-6-yl]methanone |
| SMILES | C/C=C/CNc1cccc(C(=O)c2ccc3c(/C=C/c4ccccn4)n[nH]c3c2)c1 |
| InChI | InChI=1S/C25H22N4O/c1-2-3-14-27-21-9-6-7-18(16-21)25(30)19-10-12-22-23(28-29-24(22)17-19)13-11-20-8-4-5-15-26-20/h2-13,15-17,27H,14H2,1H3,(H,28,29)/b3-2+,13-11+ |
| InChIKey | QQNAJKIHBXTNHJ-SXBUOHTDSA-N |
| XLogP | 5.35 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|