C28H20ClN5O2 — CID 91541232
2-chloro-6-methyl-N-[3-[3-(2-pyridin-2-ylethenyl)-1H-indazole-6-carbonyl]phenyl]pyridine-4-carboxamide (PubChem CID 91541232) has the molecular formula C28H20ClN5O2 and a molecular weight of 493.95 g/mol. Its IUPAC name is 2-chloro-6-methyl-N-[3-[3-(2-pyridin-2-ylethenyl)-1H-indazole-6-carbonyl]phenyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-6-methyl-N-[3-[3-(2-pyridin-2-ylethenyl)-1H-indazole-6-carbonyl]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 91541232 |
| Molecular Formula | C28H20ClN5O2 |
| Molecular Weight | 493.95 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 2-chloro-6-methyl-N-[3-[3-(2-pyridin-2-ylethenyl)-1H-indazole-6-carbonyl]phenyl]pyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cccc(C(=O)c3ccc4c(C=Cc5ccccn5)n[nH]c4c3)c2)cc(Cl)n1 |
| InChI | InChI=1S/C28H20ClN5O2/c1-17-13-20(16-26(29)31-17)28(36)32-22-7-4-5-18(14-22)27(35)19-8-10-23-24(33-34-25(23)15-19)11-9-21-6-2-3-12-30-21/h2-16H,1H3,(H,32,36)(H,33,34) |
| InChIKey | FANKZYQPLIHFFN-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.95 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|