C18H17NO4 — CID 134150003
[4-[(E)-3-(3-hydroxyphenyl)-3-oxoprop-1-enyl]phenyl] N,N-dimethylcarbamate (PubChem CID 134150003) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is [4-[(E)-3-(3-hydroxyphenyl)-3-oxoprop-1-enyl]phenyl] N,N-dimethylcarbamate.
| Compound Name | [4-[(E)-3-(3-hydroxyphenyl)-3-oxoprop-1-enyl]phenyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 134150003 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | [4-[(E)-3-(3-hydroxyphenyl)-3-oxoprop-1-enyl]phenyl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1ccc(/C=C/C(=O)c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C18H17NO4/c1-19(2)18(22)23-16-9-6-13(7-10-16)8-11-17(21)14-4-3-5-15(20)12-14/h3-12,20H,1-2H3/b11-8+ |
| InChIKey | IIGYZOUEPJQPQR-DHZHZOJOSA-N |
| XLogP | 3.35 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|