C27H26O5 — CID 142742290
(E)-3-[4,6-dimethoxy-2-[(E)-2-(4-methoxyphenyl)ethenyl]-3-methylphenyl]-1-(3-hydroxyphenyl)prop-2-en-1-one (PubChem CID 142742290) has the molecular formula C27H26O5 and a molecular weight of 430.50 g/mol. Its IUPAC name is (E)-3-[4,6-dimethoxy-2-[(E)-2-(4-methoxyphenyl)ethenyl]-3-methylphenyl]-1-(3-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[4,6-dimethoxy-2-[(E)-2-(4-methoxyphenyl)ethenyl]-3-methylphenyl]-1-(3-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 142742290 |
| Molecular Formula | C27H26O5 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | (E)-3-[4,6-dimethoxy-2-[(E)-2-(4-methoxyphenyl)ethenyl]-3-methylphenyl]-1-(3-hydroxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/c2c(C)c(OC)cc(OC)c2/C=C/C(=O)c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C27H26O5/c1-18-23(13-10-19-8-11-22(30-2)12-9-19)24(27(32-4)17-26(18)31-3)14-15-25(29)20-6-5-7-21(28)16-20/h5-17,28H,1-4H3/b13-10+,15-14+ |
| InChIKey | ZHWBRHKPAFKRLF-HFEXRDJISA-N |
| XLogP | 5.79 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|