C32H46N8O5 — CID 134152267
2-[3-[(2S,5R,8R,11R)-8-(4-aminobutyl)-5-benzyl-11-[(4-hydroxy-2,6-dimethylphenyl)methyl]-3,6,9,12-tetraoxo-1,4,7,10-tetrazacyclododec-2-yl]propyl]guanidine (PubChem CID 134152267) has the molecular formula C32H46N8O5 and a molecular weight of 622.77 g/mol. Its IUPAC name is 2-[3-[(2S,5R,8R,11R)-8-(4-aminobutyl)-5-benzyl-11-[(4-hydroxy-2,6-dimethylphenyl)methyl]-3,6,9,12-tetraoxo-1,4,7,10-tetrazacyclododec-2-yl]propyl]guanidine.
| Compound Name | 2-[3-[(2S,5R,8R,11R)-8-(4-aminobutyl)-5-benzyl-11-[(4-hydroxy-2,6-dimethylphenyl)methyl]-3,6,9,12-tetraoxo-1,4,7,10-tetrazacyclododec-2-yl]propyl]guanidine |
|---|---|
| PubChem CID | 134152267 |
| Molecular Formula | C32H46N8O5 |
| Molecular Weight | 622.77 g/mol |
| Exact Mass | 622.36 |
| IUPAC Name | 2-[3-[(2S,5R,8R,11R)-8-(4-aminobutyl)-5-benzyl-11-[(4-hydroxy-2,6-dimethylphenyl)methyl]-3,6,9,12-tetraoxo-1,4,7,10-tetrazacyclododec-2-yl]propyl]guanidine |
| SMILES | Cc1cc(O)cc(C)c1C[C@H]1NC(=O)[C@@H](CCCCN)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](CCCN=C(N)N)NC1=O |
| InChI | InChI=1S/C32H46N8O5/c1-19-15-22(41)16-20(2)23(19)18-27-31(45)38-25(12-8-14-36-32(34)35)29(43)39-26(17-21-9-4-3-5-10-21)30(44)37-24(28(42)40-27)11-6-7-13-33/h3-5,9-10,15-16,24-27,41H,6-8,11-14,17-18,33H2,1-2H3,(H,37,44)(H,38,45)(H,39,43)(H,40,42)(H4,34,35,36)/t24-,25+,26-,27-/m1/s1 |
| InChIKey | RDVGYJZVBMSCFU-HVWQDESWSA-N |
| XLogP | -0.07 |
| TPSA | 227.05 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.77 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|