About methyl 6-hydroxy-3,3-dimethylcyclohexene-1-carboxylate
methyl 6-hydroxy-3,3-dimethylcyclohexene-1-carboxylate (PubChem CID 134152353) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is methyl 6-hydroxy-3,3-dimethylcyclohexene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 6-hydroxy-3,3-dimethylcyclohexene-1-carboxylate |
| PubChem CID | 134152353 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | methyl 6-hydroxy-3,3-dimethylcyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=CC(C)(C)CCC1O |
| InChI | InChI=1S/C10H16O3/c1-10(2)5-4-8(11)7(6-10)9(12)13-3/h6,8,11H,4-5H2,1-3H3 |
| InChIKey | DTLDGAQUUVCLEC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 6-hydroxy-3,3-dimethylcyclohexene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-hydroxy-3,3-dimethylcyclohexene-1-carboxylate?
The IUPAC name of methyl 6-hydroxy-3,3-dimethylcyclohexene-1-carboxylate (CID 134152353) is methyl 6-hydroxy-3,3-dimethylcyclohexene-1-carboxylate.
What is the SMILES notation for methyl 6-hydroxy-3,3-dimethylcyclohexene-1-carboxylate?
The canonical SMILES for methyl 6-hydroxy-3,3-dimethylcyclohexene-1-carboxylate is COC(=O)C1=CC(C)(C)CCC1O.
What is the InChIKey of methyl 6-hydroxy-3,3-dimethylcyclohexene-1-carboxylate?
The InChIKey is DTLDGAQUUVCLEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-10(2)5-4-8(11)7(6-10)9(12)13-3/h6,8,11H,4-5H2,1-3H3.
What are the key properties of methyl 6-hydroxy-3,3-dimethylcyclohexene-1-carboxylate?
methyl 6-hydroxy-3,3-dimethylcyclohexene-1-carboxylate has a molecular weight of 184.23 g/mol, XLogP of 1.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-hydroxy-3,3-dimethylcyclohexene-1-carboxylate is sourced from PubChem (CID 134152353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).