C20H16F3N5 — CID 134152596
5-[[3-[3-(trifluoromethyl)phenyl]indol-1-yl]methyl]pyrimidine-2,4-diamine (PubChem CID 134152596) has the molecular formula C20H16F3N5 and a molecular weight of 383.38 g/mol. Its IUPAC name is 5-[[3-[3-(trifluoromethyl)phenyl]indol-1-yl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[[3-[3-(trifluoromethyl)phenyl]indol-1-yl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 134152596 |
| Molecular Formula | C20H16F3N5 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 5-[[3-[3-(trifluoromethyl)phenyl]indol-1-yl]methyl]pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(Cn2cc(-c3cccc(C(F)(F)F)c3)c3ccccc32)c(N)n1 |
| InChI | InChI=1S/C20H16F3N5/c21-20(22,23)14-5-3-4-12(8-14)16-11-28(17-7-2-1-6-15(16)17)10-13-9-26-19(25)27-18(13)24/h1-9,11H,10H2,(H4,24,25,26,27) |
| InChIKey | TZZFGNIDHKLBES-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |