About 2-(4-bromophenyl)-3-(4-methylphenyl)-5,7-diphenylindolizine
2-(4-bromophenyl)-3-(4-methylphenyl)-5,7-diphenylindolizine (PubChem CID 13415490) has the molecular formula C33H24BrN
and a molecular weight of 514.47 g/mol. Its IUPAC name is 2-(4-bromophenyl)-3-(4-methylphenyl)-5,7-diphenylindolizine.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-3-(4-methylphenyl)-5,7-diphenylindolizine |
| PubChem CID | 13415490 |
| Molecular Formula | C33H24BrN |
| Molecular Weight | 514.47 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | 2-(4-bromophenyl)-3-(4-methylphenyl)-5,7-diphenylindolizine |
| SMILES | Cc1ccc(-c2c(-c3ccc(Br)cc3)cc3cc(-c4ccccc4)cc(-c4ccccc4)n23)cc1 |
| InChI | InChI=1S/C33H24BrN/c1-23-12-14-27(15-13-23)33-31(25-16-18-29(34)19-17-25)22-30-20-28(24-8-4-2-5-9-24)21-32(35(30)33)26-10-6-3-7-11-26/h2-22H,1H3 |
| InChIKey | WXMORMVLBKEVFT-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.47 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-bromophenyl)-3-(4-methylphenyl)-5,7-diphenylindolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-3-(4-methylphenyl)-5,7-diphenylindolizine?
The IUPAC name of 2-(4-bromophenyl)-3-(4-methylphenyl)-5,7-diphenylindolizine (CID 13415490) is 2-(4-bromophenyl)-3-(4-methylphenyl)-5,7-diphenylindolizine.
What is the SMILES notation for 2-(4-bromophenyl)-3-(4-methylphenyl)-5,7-diphenylindolizine?
The canonical SMILES for 2-(4-bromophenyl)-3-(4-methylphenyl)-5,7-diphenylindolizine is Cc1ccc(-c2c(-c3ccc(Br)cc3)cc3cc(-c4ccccc4)cc(-c4ccccc4)n23)cc1.
What is the InChIKey of 2-(4-bromophenyl)-3-(4-methylphenyl)-5,7-diphenylindolizine?
The InChIKey is WXMORMVLBKEVFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H24BrN/c1-23-12-14-27(15-13-23)33-31(25-16-18-29(34)19-17-25)22-30-20-28(24-8-4-2-5-9-24)21-32(35(30)33)26-10-6-3-7-11-26/h2-22H,1H3.
What are the key properties of 2-(4-bromophenyl)-3-(4-methylphenyl)-5,7-diphenylindolizine?
2-(4-bromophenyl)-3-(4-methylphenyl)-5,7-diphenylindolizine has a molecular weight of 514.47 g/mol, XLogP of 9.68, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-3-(4-methylphenyl)-5,7-diphenylindolizine is sourced from PubChem (CID 13415490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).