About 9-(3,5-dibromophenyl)carbazole
9-(3,5-dibromophenyl)carbazole (PubChem CID 22667344) has the molecular formula C18H11Br2N
and a molecular weight of 401.10 g/mol. Its IUPAC name is 9-(3,5-dibromophenyl)carbazole.
Molecular Properties
| Compound Name | 9-(3,5-dibromophenyl)carbazole |
| PubChem CID | 22667344 |
| Molecular Formula | C18H11Br2N |
| Molecular Weight | 401.10 g/mol |
| Exact Mass | 398.93 |
| IUPAC Name | 9-(3,5-dibromophenyl)carbazole |
| SMILES | Brc1cc(Br)cc(-n2c3ccccc3c3ccccc32)c1 |
| InChI | InChI=1S/C18H11Br2N/c19-12-9-13(20)11-14(10-12)21-17-7-3-1-5-15(17)16-6-2-4-8-18(16)21/h1-11H |
| InChIKey | YXHXRBIAIVNCPG-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.10 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-(3,5-dibromophenyl)carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(3,5-dibromophenyl)carbazole?
The IUPAC name of 9-(3,5-dibromophenyl)carbazole (CID 22667344) is 9-(3,5-dibromophenyl)carbazole.
What is the SMILES notation for 9-(3,5-dibromophenyl)carbazole?
The canonical SMILES for 9-(3,5-dibromophenyl)carbazole is Brc1cc(Br)cc(-n2c3ccccc3c3ccccc32)c1.
What is the InChIKey of 9-(3,5-dibromophenyl)carbazole?
The InChIKey is YXHXRBIAIVNCPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11Br2N/c19-12-9-13(20)11-14(10-12)21-17-7-3-1-5-15(17)16-6-2-4-8-18(16)21/h1-11H.
What are the key properties of 9-(3,5-dibromophenyl)carbazole?
9-(3,5-dibromophenyl)carbazole has a molecular weight of 401.10 g/mol, XLogP of 6.31, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(3,5-dibromophenyl)carbazole is sourced from PubChem (CID 22667344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).