C27H38O3 — CID 134155047
[(1R,2S,5E,9E,12S)-1,5,9-trimethyl-12-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-yl] benzoate (PubChem CID 134155047) has the molecular formula C27H38O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is [(1R,2S,5E,9E,12S)-1,5,9-trimethyl-12-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-yl] benzoate.
| Compound Name | [(1R,2S,5E,9E,12S)-1,5,9-trimethyl-12-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-yl] benzoate |
|---|---|
| PubChem CID | 134155047 |
| Molecular Formula | C27H38O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | [(1R,2S,5E,9E,12S)-1,5,9-trimethyl-12-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-yl] benzoate |
| SMILES | C/C1=C\C[C@]2(C(C)C)CC[C@@](C)(O2)[C@@H](OC(=O)c2ccccc2)CC/C(C)=C/CC1 |
| InChI | InChI=1S/C27H38O3/c1-20(2)27-17-16-22(4)11-9-10-21(3)14-15-24(26(5,30-27)18-19-27)29-25(28)23-12-7-6-8-13-23/h6-8,10,12-13,16,20,24H,9,11,14-15,17-19H2,1-5H3/b21-10+,22-16+/t24-,26+,27+/m0/s1 |
| InChIKey | AKGLTDYPASAOIS-XEYDJRIMSA-N |
| XLogP | 7.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|