C25H24N2O6 — CID 134155621
N-methyl-4-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]phenoxy]pyridine-2-carboxamide (PubChem CID 134155621) has the molecular formula C25H24N2O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is N-methyl-4-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]phenoxy]pyridine-2-carboxamide.
| Compound Name | N-methyl-4-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]phenoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 134155621 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N-methyl-4-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]phenoxy]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc(C(=O)/C=C/c3cc(OC)c(OC)c(OC)c3)cc2)ccn1 |
| InChI | InChI=1S/C25H24N2O6/c1-26-25(29)20-15-19(11-12-27-20)33-18-8-6-17(7-9-18)21(28)10-5-16-13-22(30-2)24(32-4)23(14-16)31-3/h5-15H,1-4H3,(H,26,29)/b10-5+ |
| InChIKey | MCZQGTUALZBNEC-BJMVGYQFSA-N |
| XLogP | 4.16 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|