C17H20N4O5 — CID 6498566
N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]pyrazine-2-carboxamide (PubChem CID 6498566) has the molecular formula C17H20N4O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]pyrazine-2-carboxamide.
| Compound Name | N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 6498566 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]pyrazine-2-carboxamide |
| SMILES | COc1cc(C(=O)NCCNC(=O)c2cnccn2)cc(OC)c1OC |
| InChI | InChI=1S/C17H20N4O5/c1-24-13-8-11(9-14(25-2)15(13)26-3)16(22)20-6-7-21-17(23)12-10-18-4-5-19-12/h4-5,8-10H,6-7H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | ZGJQGZMBLAUMKB-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|