C21H25ClFNO2 — CID 134158108
(2S)-1-[2-(4-chlorophenoxy)-3-fluorophenoxy]-3-cyclohexylpropan-2-amine (PubChem CID 134158108) has the molecular formula C21H25ClFNO2 and a molecular weight of 377.89 g/mol. Its IUPAC name is (2S)-1-[2-(4-chlorophenoxy)-3-fluorophenoxy]-3-cyclohexylpropan-2-amine.
| Compound Name | (2S)-1-[2-(4-chlorophenoxy)-3-fluorophenoxy]-3-cyclohexylpropan-2-amine |
|---|---|
| PubChem CID | 134158108 |
| Molecular Formula | C21H25ClFNO2 |
| Molecular Weight | 377.89 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (2S)-1-[2-(4-chlorophenoxy)-3-fluorophenoxy]-3-cyclohexylpropan-2-amine |
| SMILES | N[C@H](COc1cccc(F)c1Oc1ccc(Cl)cc1)CC1CCCCC1 |
| InChI | InChI=1S/C21H25ClFNO2/c22-16-9-11-18(12-10-16)26-21-19(23)7-4-8-20(21)25-14-17(24)13-15-5-2-1-3-6-15/h4,7-12,15,17H,1-3,5-6,13-14,24H2/t17-/m0/s1 |
| InChIKey | BYOSTPZTVKSJSV-KRWDZBQOSA-N |
| XLogP | 5.95 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.89 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |