C32H40N4O5S — CID 134158905
2-[4-[7-butyl-3-[2-(diethylamino)-2-oxoethyl]-5-methylpyrazolo[1,5-a]pyrimidin-2-yl]phenoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 134158905) has the molecular formula C32H40N4O5S and a molecular weight of 592.76 g/mol. Its IUPAC name is 2-[4-[7-butyl-3-[2-(diethylamino)-2-oxoethyl]-5-methylpyrazolo[1,5-a]pyrimidin-2-yl]phenoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[4-[7-butyl-3-[2-(diethylamino)-2-oxoethyl]-5-methylpyrazolo[1,5-a]pyrimidin-2-yl]phenoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134158905 |
| Molecular Formula | C32H40N4O5S |
| Molecular Weight | 592.76 g/mol |
| Exact Mass | 592.27 |
| IUPAC Name | 2-[4-[7-butyl-3-[2-(diethylamino)-2-oxoethyl]-5-methylpyrazolo[1,5-a]pyrimidin-2-yl]phenoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | CCCCc1cc(C)nc2c(CC(=O)N(CC)CC)c(-c3ccc(OCCOS(=O)(=O)c4ccc(C)cc4)cc3)nn12 |
| InChI | InChI=1S/C32H40N4O5S/c1-6-9-10-26-21-24(5)33-32-29(22-30(37)35(7-2)8-3)31(34-36(26)32)25-13-15-27(16-14-25)40-19-20-41-42(38,39)28-17-11-23(4)12-18-28/h11-18,21H,6-10,19-20,22H2,1-5H3 |
| InChIKey | WRGALHRNUKXRDD-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 103.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.76 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|