C8H10N2O3 — CID 134159226
6-nitro-3,4,4a,8a-tetrahydro-2H-1,4-benzoxazine (PubChem CID 134159226) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is 6-nitro-3,4,4a,8a-tetrahydro-2H-1,4-benzoxazine.
| Compound Name | 6-nitro-3,4,4a,8a-tetrahydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 134159226 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 6-nitro-3,4,4a,8a-tetrahydro-2H-1,4-benzoxazine |
| SMILES | O=[N+]([O-])C1=CC2NCCOC2C=C1 |
| InChI | InChI=1S/C8H10N2O3/c11-10(12)6-1-2-8-7(5-6)9-3-4-13-8/h1-2,5,7-9H,3-4H2 |
| InChIKey | YGJVDANLJXJOCH-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|