C15H25N3O3 — CID 145202688
ethane;4-ethenyl-3-[(E)-2-nitrobut-1-enyl]-1,6,7,8,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine (PubChem CID 145202688) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is ethane;4-ethenyl-3-[(E)-2-nitrobut-1-enyl]-1,6,7,8,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine.
| Compound Name | ethane;4-ethenyl-3-[(E)-2-nitrobut-1-enyl]-1,6,7,8,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 145202688 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | ethane;4-ethenyl-3-[(E)-2-nitrobut-1-enyl]-1,6,7,8,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine |
| SMILES | C=CC1=C(/C=C(\CC)[N+](=O)[O-])OCC2CNCCN12.CC |
| InChI | InChI=1S/C13H19N3O3.C2H6/c1-3-10(16(17)18)7-13-12(4-2)15-6-5-14-8-11(15)9-19-13;1-2/h4,7,11,14H,2-3,5-6,8-9H2,1H3;1-2H3/b10-7+; |
| InChIKey | AWAHDCDSSCLEIH-HCUGZAAXSA-N |
| XLogP | 2.28 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|