C12H15N3O3S — CID 134160473
4-(oxolane-3-carbonyl)-1-(1,3-thiazol-2-yl)piperazin-2-one (PubChem CID 134160473) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 4-(oxolane-3-carbonyl)-1-(1,3-thiazol-2-yl)piperazin-2-one.
| Compound Name | 4-(oxolane-3-carbonyl)-1-(1,3-thiazol-2-yl)piperazin-2-one |
|---|---|
| PubChem CID | 134160473 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 4-(oxolane-3-carbonyl)-1-(1,3-thiazol-2-yl)piperazin-2-one |
| SMILES | O=C(C1CCOC1)N1CCN(c2nccs2)C(=O)C1 |
| InChI | InChI=1S/C12H15N3O3S/c16-10-7-14(11(17)9-1-5-18-8-9)3-4-15(10)12-13-2-6-19-12/h2,6,9H,1,3-5,7-8H2 |
| InChIKey | BMLZYHHFQLXKFZ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |