C16H24N4O3S — CID 46957201
1-(3-methoxypropyl)-4-[4-(1,3-thiazol-2-yl)piperazine-1-carbonyl]pyrrolidin-2-one (PubChem CID 46957201) has the molecular formula C16H24N4O3S and a molecular weight of 352.46 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-4-[4-(1,3-thiazol-2-yl)piperazine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-(3-methoxypropyl)-4-[4-(1,3-thiazol-2-yl)piperazine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 46957201 |
| Molecular Formula | C16H24N4O3S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 1-(3-methoxypropyl)-4-[4-(1,3-thiazol-2-yl)piperazine-1-carbonyl]pyrrolidin-2-one |
| SMILES | COCCCN1CC(C(=O)N2CCN(c3nccs3)CC2)CC1=O |
| InChI | InChI=1S/C16H24N4O3S/c1-23-9-2-4-20-12-13(11-14(20)21)15(22)18-5-7-19(8-6-18)16-17-3-10-24-16/h3,10,13H,2,4-9,11-12H2,1H3 |
| InChIKey | YUJPQKGIJZPYQL-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|