C12H16N4O3 — CID 134162907
[5-(azidomethyl)furan-2-yl]-[(2R,6S)-2,6-dimethylmorpholin-4-yl]methanone (PubChem CID 134162907) has the molecular formula C12H16N4O3 and a molecular weight of 264.29 g/mol. Its IUPAC name is [5-(azidomethyl)furan-2-yl]-[(2R,6S)-2,6-dimethylmorpholin-4-yl]methanone.
| Compound Name | [5-(azidomethyl)furan-2-yl]-[(2R,6S)-2,6-dimethylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 134162907 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | [5-(azidomethyl)furan-2-yl]-[(2R,6S)-2,6-dimethylmorpholin-4-yl]methanone |
| SMILES | C[C@@H]1CN(C(=O)c2ccc(CN=[N+]=[N-])o2)C[C@H](C)O1 |
| InChI | InChI=1S/C12H16N4O3/c1-8-6-16(7-9(2)18-8)12(17)11-4-3-10(19-11)5-14-15-13/h3-4,8-9H,5-7H2,1-2H3/t8-,9+ |
| InChIKey | OBKRJWPLGHLLLZ-DTORHVGOSA-N |
| XLogP | 2.34 |
| TPSA | 91.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|