C24H25N5O2 — CID 134164673
4-ethoxy-2-(4-methylphenyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]quinoline-7-carboxamide (PubChem CID 134164673) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is 4-ethoxy-2-(4-methylphenyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]quinoline-7-carboxamide.
| Compound Name | 4-ethoxy-2-(4-methylphenyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 134164673 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 4-ethoxy-2-(4-methylphenyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]quinoline-7-carboxamide |
| SMILES | CCOc1cc(-c2ccc(C)cc2)nc2cc(C(=O)NCCCc3ncn[nH]3)ccc12 |
| InChI | InChI=1S/C24H25N5O2/c1-3-31-22-14-20(17-8-6-16(2)7-9-17)28-21-13-18(10-11-19(21)22)24(30)25-12-4-5-23-26-15-27-29-23/h6-11,13-15H,3-5,12H2,1-2H3,(H,25,30)(H,26,27,29) |
| InChIKey | ZPFNSNCZRLHSQI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|