C25H27N5O2 — CID 134164669
4-ethoxy-2-(3-methylphenyl)-N-[3-(5-methyl-2H-triazol-4-yl)propyl]quinoline-7-carboxamide (PubChem CID 134164669) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is 4-ethoxy-2-(3-methylphenyl)-N-[3-(5-methyl-2H-triazol-4-yl)propyl]quinoline-7-carboxamide.
| Compound Name | 4-ethoxy-2-(3-methylphenyl)-N-[3-(5-methyl-2H-triazol-4-yl)propyl]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 134164669 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 4-ethoxy-2-(3-methylphenyl)-N-[3-(5-methyl-2H-triazol-4-yl)propyl]quinoline-7-carboxamide |
| SMILES | CCOc1cc(-c2cccc(C)c2)nc2cc(C(=O)NCCCc3n[nH]nc3C)ccc12 |
| InChI | InChI=1S/C25H27N5O2/c1-4-32-24-15-22(18-8-5-7-16(2)13-18)27-23-14-19(10-11-20(23)24)25(31)26-12-6-9-21-17(3)28-30-29-21/h5,7-8,10-11,13-15H,4,6,9,12H2,1-3H3,(H,26,31)(H,28,29,30) |
| InChIKey | RDJKDFPOIMEIDH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|