C23H24FN5O2 — CID 145126632
4-ethoxy-2-(4-fluorophenyl)-N-[(3Z)-3-hydrazinylidene-4-iminopentyl]quinoline-7-carboxamide (PubChem CID 145126632) has the molecular formula C23H24FN5O2 and a molecular weight of 421.48 g/mol. Its IUPAC name is 4-ethoxy-2-(4-fluorophenyl)-N-[(3Z)-3-hydrazinylidene-4-iminopentyl]quinoline-7-carboxamide.
| Compound Name | 4-ethoxy-2-(4-fluorophenyl)-N-[(3Z)-3-hydrazinylidene-4-iminopentyl]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 145126632 |
| Molecular Formula | C23H24FN5O2 |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 4-ethoxy-2-(4-fluorophenyl)-N-[(3Z)-3-hydrazinylidene-4-iminopentyl]quinoline-7-carboxamide |
| SMILES | [H]/N=C(C)/C(CCNC(=O)c1ccc2c(OCC)cc(-c3ccc(F)cc3)nc2c1)=N\N |
| InChI | InChI=1S/C23H24FN5O2/c1-3-31-22-13-20(15-4-7-17(24)8-5-15)28-21-12-16(6-9-18(21)22)23(30)27-11-10-19(29-26)14(2)25/h4-9,12-13,25H,3,10-11,26H2,1-2H3,(H,27,30)/b25-14+,29-19- |
| InChIKey | IPICJQNKJAAQOZ-HTSKQLGVSA-N |
| XLogP | 3.91 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|