C23H23F2N5O2 — CID 122431394
N-[3-(2,3-dihydro-1H-triazol-4-yl)propyl]-4-ethoxy-3-fluoro-2-(4-fluorophenyl)quinoline-7-carboxamide (PubChem CID 122431394) has the molecular formula C23H23F2N5O2 and a molecular weight of 439.47 g/mol. Its IUPAC name is N-[3-(2,3-dihydro-1H-triazol-4-yl)propyl]-4-ethoxy-3-fluoro-2-(4-fluorophenyl)quinoline-7-carboxamide.
| Compound Name | N-[3-(2,3-dihydro-1H-triazol-4-yl)propyl]-4-ethoxy-3-fluoro-2-(4-fluorophenyl)quinoline-7-carboxamide |
|---|---|
| PubChem CID | 122431394 |
| Molecular Formula | C23H23F2N5O2 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | N-[3-(2,3-dihydro-1H-triazol-4-yl)propyl]-4-ethoxy-3-fluoro-2-(4-fluorophenyl)quinoline-7-carboxamide |
| SMILES | CCOc1c(F)c(-c2ccc(F)cc2)nc2cc(C(=O)NCCCC3=CNNN3)ccc12 |
| InChI | InChI=1S/C23H23F2N5O2/c1-2-32-22-18-10-7-15(23(31)26-11-3-4-17-13-27-30-29-17)12-19(18)28-21(20(22)25)14-5-8-16(24)9-6-14/h5-10,12-13,27,29-30H,2-4,11H2,1H3,(H,26,31) |
| InChIKey | NBANWYFXJJBTPD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|