C28H20F5N5O — CID 118463972
2-(4-fluorophenyl)-3-[2-fluoro-5-(trifluoromethyl)phenyl]-N-[3-(1H-imidazol-2-yl)propyl]quinoxaline-6-carboxamide (PubChem CID 118463972) has the molecular formula C28H20F5N5O and a molecular weight of 537.49 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3-[2-fluoro-5-(trifluoromethyl)phenyl]-N-[3-(1H-imidazol-2-yl)propyl]quinoxaline-6-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-3-[2-fluoro-5-(trifluoromethyl)phenyl]-N-[3-(1H-imidazol-2-yl)propyl]quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 118463972 |
| Molecular Formula | C28H20F5N5O |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | 2-(4-fluorophenyl)-3-[2-fluoro-5-(trifluoromethyl)phenyl]-N-[3-(1H-imidazol-2-yl)propyl]quinoxaline-6-carboxamide |
| SMILES | O=C(NCCCc1ncc[nH]1)c1ccc2nc(-c3ccc(F)cc3)c(-c3cc(C(F)(F)F)ccc3F)nc2c1 |
| InChI | InChI=1S/C28H20F5N5O/c29-19-7-3-16(4-8-19)25-26(20-15-18(28(31,32)33)6-9-21(20)30)38-23-14-17(5-10-22(23)37-25)27(39)36-11-1-2-24-34-12-13-35-24/h3-10,12-15H,1-2,11H2,(H,34,35)(H,36,39) |
| InChIKey | WNIHKCAGIJXXHW-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|