C27H19F4N5O — CID 118463473
2-(4-fluorophenyl)-N-[3-(1H-imidazol-2-yl)propyl]-3-(2,4,5-trifluorophenyl)quinoxaline-6-carboxamide (PubChem CID 118463473) has the molecular formula C27H19F4N5O and a molecular weight of 505.48 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[3-(1H-imidazol-2-yl)propyl]-3-(2,4,5-trifluorophenyl)quinoxaline-6-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-[3-(1H-imidazol-2-yl)propyl]-3-(2,4,5-trifluorophenyl)quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 118463473 |
| Molecular Formula | C27H19F4N5O |
| Molecular Weight | 505.48 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[3-(1H-imidazol-2-yl)propyl]-3-(2,4,5-trifluorophenyl)quinoxaline-6-carboxamide |
| SMILES | O=C(NCCCc1ncc[nH]1)c1ccc2nc(-c3ccc(F)cc3)c(-c3cc(F)c(F)cc3F)nc2c1 |
| InChI | InChI=1S/C27H19F4N5O/c28-17-6-3-15(4-7-17)25-26(18-13-20(30)21(31)14-19(18)29)36-23-12-16(5-8-22(23)35-25)27(37)34-9-1-2-24-32-10-11-33-24/h3-8,10-14H,1-2,9H2,(H,32,33)(H,34,37) |
| InChIKey | XUCKDQPCGZDUSU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.48 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|