C27H22F2N6O2 — CID 118463759
3-(3-fluoro-2-methoxy-4-pyridinyl)-2-(4-fluorophenyl)-N-[3-(1H-imidazol-2-yl)propyl]quinoxaline-6-carboxamide (PubChem CID 118463759) has the molecular formula C27H22F2N6O2 and a molecular weight of 500.51 g/mol. Its IUPAC name is 3-(3-fluoro-2-methoxy-4-pyridinyl)-2-(4-fluorophenyl)-N-[3-(1H-imidazol-2-yl)propyl]quinoxaline-6-carboxamide.
| Compound Name | 3-(3-fluoro-2-methoxy-4-pyridinyl)-2-(4-fluorophenyl)-N-[3-(1H-imidazol-2-yl)propyl]quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 118463759 |
| Molecular Formula | C27H22F2N6O2 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 3-(3-fluoro-2-methoxy-4-pyridinyl)-2-(4-fluorophenyl)-N-[3-(1H-imidazol-2-yl)propyl]quinoxaline-6-carboxamide |
| SMILES | COc1nccc(-c2nc3cc(C(=O)NCCCc4ncc[nH]4)ccc3nc2-c2ccc(F)cc2)c1F |
| InChI | InChI=1S/C27H22F2N6O2/c1-37-27-23(29)19(10-12-33-27)25-24(16-4-7-18(28)8-5-16)34-20-9-6-17(15-21(20)35-25)26(36)32-11-2-3-22-30-13-14-31-22/h4-10,12-15H,2-3,11H2,1H3,(H,30,31)(H,32,36) |
| InChIKey | LTYIVBLGRNDCEG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|