C25H24F3N5O2S — CID 118463636
N-[3-(1H-imidazol-2-yl)propyl]-2-propan-2-yloxy-3-[3-(trifluoromethylsulfanyl)phenyl]quinoxaline-6-carboxamide (PubChem CID 118463636) has the molecular formula C25H24F3N5O2S and a molecular weight of 515.56 g/mol. Its IUPAC name is N-[3-(1H-imidazol-2-yl)propyl]-2-propan-2-yloxy-3-[3-(trifluoromethylsulfanyl)phenyl]quinoxaline-6-carboxamide.
| Compound Name | N-[3-(1H-imidazol-2-yl)propyl]-2-propan-2-yloxy-3-[3-(trifluoromethylsulfanyl)phenyl]quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 118463636 |
| Molecular Formula | C25H24F3N5O2S |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | N-[3-(1H-imidazol-2-yl)propyl]-2-propan-2-yloxy-3-[3-(trifluoromethylsulfanyl)phenyl]quinoxaline-6-carboxamide |
| SMILES | CC(C)Oc1nc2ccc(C(=O)NCCCc3ncc[nH]3)cc2nc1-c1cccc(SC(F)(F)F)c1 |
| InChI | InChI=1S/C25H24F3N5O2S/c1-15(2)35-24-22(16-5-3-6-18(13-16)36-25(26,27)28)32-20-14-17(8-9-19(20)33-24)23(34)31-10-4-7-21-29-11-12-30-21/h3,5-6,8-9,11-15H,4,7,10H2,1-2H3,(H,29,30)(H,31,34) |
| InChIKey | SLLOOWOCEIDSKV-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|