C27H21ClF2N6 — CID 163696733
3-(5-chloro-2-fluorophenyl)-2-(4-fluorophenyl)-N'-[3-(1H-imidazol-2-yl)propyl]quinoxaline-6-carboximidamide (PubChem CID 163696733) has the molecular formula C27H21ClF2N6 and a molecular weight of 502.96 g/mol. Its IUPAC name is 3-(5-chloro-2-fluorophenyl)-2-(4-fluorophenyl)-N'-[3-(1H-imidazol-2-yl)propyl]quinoxaline-6-carboximidamide.
| Compound Name | 3-(5-chloro-2-fluorophenyl)-2-(4-fluorophenyl)-N'-[3-(1H-imidazol-2-yl)propyl]quinoxaline-6-carboximidamide |
|---|---|
| PubChem CID | 163696733 |
| Molecular Formula | C27H21ClF2N6 |
| Molecular Weight | 502.96 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 3-(5-chloro-2-fluorophenyl)-2-(4-fluorophenyl)-N'-[3-(1H-imidazol-2-yl)propyl]quinoxaline-6-carboximidamide |
| SMILES | N/C(=N\CCCc1ncc[nH]1)c1ccc2nc(-c3ccc(F)cc3)c(-c3cc(Cl)ccc3F)nc2c1 |
| InChI | InChI=1S/C27H21ClF2N6/c28-18-6-9-21(30)20(15-18)26-25(16-3-7-19(29)8-4-16)35-22-10-5-17(14-23(22)36-26)27(31)34-11-1-2-24-32-12-13-33-24/h3-10,12-15H,1-2,11H2,(H2,31,34)(H,32,33) |
| InChIKey | JXPCIUKOTBOMFG-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.96 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|