C20H24FN5 — CID 4915581
N'-[2-(diethylamino)ethyl]-2-(4-fluorophenyl)-3H-benzimidazole-5-carboximidamide (PubChem CID 4915581) has the molecular formula C20H24FN5 and a molecular weight of 353.45 g/mol. Its IUPAC name is N'-[2-(diethylamino)ethyl]-2-(4-fluorophenyl)-3H-benzimidazole-5-carboximidamide.
| Compound Name | N'-[2-(diethylamino)ethyl]-2-(4-fluorophenyl)-3H-benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 4915581 |
| Molecular Formula | C20H24FN5 |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | N'-[2-(diethylamino)ethyl]-2-(4-fluorophenyl)-3H-benzimidazole-5-carboximidamide |
| SMILES | CCN(CC)CC/N=C(\N)c1ccc2nc(-c3ccc(F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C20H24FN5/c1-3-26(4-2)12-11-23-19(22)15-7-10-17-18(13-15)25-20(24-17)14-5-8-16(21)9-6-14/h5-10,13H,3-4,11-12H2,1-2H3,(H2,22,23)(H,24,25) |
| InChIKey | PBBSRHUEYCTLGF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 70.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|