C38H42N8 — CID 11399319
N'-butyl-2-[4-[2-[4-[6-(N'-butylcarbamimidoyl)-1H-benzimidazol-2-yl]phenyl]ethyl]phenyl]-3H-benzimidazole-5-carboximidamide (PubChem CID 11399319) has the molecular formula C38H42N8 and a molecular weight of 610.81 g/mol. Its IUPAC name is N'-butyl-2-[4-[2-[4-[6-(N'-butylcarbamimidoyl)-1H-benzimidazol-2-yl]phenyl]ethyl]phenyl]-3H-benzimidazole-5-carboximidamide.
| Compound Name | N'-butyl-2-[4-[2-[4-[6-(N'-butylcarbamimidoyl)-1H-benzimidazol-2-yl]phenyl]ethyl]phenyl]-3H-benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 11399319 |
| Molecular Formula | C38H42N8 |
| Molecular Weight | 610.81 g/mol |
| Exact Mass | 610.35 |
| IUPAC Name | N'-butyl-2-[4-[2-[4-[6-(N'-butylcarbamimidoyl)-1H-benzimidazol-2-yl]phenyl]ethyl]phenyl]-3H-benzimidazole-5-carboximidamide |
| SMILES | CCCC/N=C(\N)c1ccc2nc(-c3ccc(CCc4ccc(-c5nc6ccc(/C(N)=N/CCCC)cc6[nH]5)cc4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C38H42N8/c1-3-5-21-41-35(39)29-17-19-31-33(23-29)45-37(43-31)27-13-9-25(10-14-27)7-8-26-11-15-28(16-12-26)38-44-32-20-18-30(24-34(32)46-38)36(40)42-22-6-4-2/h9-20,23-24H,3-8,21-22H2,1-2H3,(H2,39,41)(H2,40,42)(H,43,45)(H,44,46) |
| InChIKey | NDXCDBBFIUYZEU-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 134.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.81 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|