C34H30Cl2N8S — CID 70595089
N'-benzyl-2-[5-[6-(N'-benzylcarbamimidoyl)-1H-benzimidazol-2-yl]thiophen-2-yl]-3H-benzimidazole-5-carboximidamide;dihydrochloride (PubChem CID 70595089) has the molecular formula C34H30Cl2N8S and a molecular weight of 653.64 g/mol. Its IUPAC name is N'-benzyl-2-[5-[6-(N'-benzylcarbamimidoyl)-1H-benzimidazol-2-yl]thiophen-2-yl]-3H-benzimidazole-5-carboximidamide;dihydrochloride.
| Compound Name | N'-benzyl-2-[5-[6-(N'-benzylcarbamimidoyl)-1H-benzimidazol-2-yl]thiophen-2-yl]-3H-benzimidazole-5-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 70595089 |
| Molecular Formula | C34H30Cl2N8S |
| Molecular Weight | 653.64 g/mol |
| Exact Mass | 652.17 |
| IUPAC Name | N'-benzyl-2-[5-[6-(N'-benzylcarbamimidoyl)-1H-benzimidazol-2-yl]thiophen-2-yl]-3H-benzimidazole-5-carboximidamide;dihydrochloride |
| SMILES | Cl.Cl.N/C(=N\Cc1ccccc1)c1ccc2nc(-c3ccc(-c4nc5ccc(/C(N)=N/Cc6ccccc6)cc5[nH]4)s3)[nH]c2c1 |
| InChI | InChI=1S/C34H28N8S.2ClH/c35-31(37-19-21-7-3-1-4-8-21)23-11-13-25-27(17-23)41-33(39-25)29-15-16-30(43-29)34-40-26-14-12-24(18-28(26)42-34)32(36)38-20-22-9-5-2-6-10-22;;/h1-18H,19-20H2,(H2,35,37)(H2,36,38)(H,39,41)(H,40,42);2*1H |
| InChIKey | JDMFRTPSSOIGKB-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 134.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.64 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|