C19H13FN2O2S — CID 157232904
1-[2-[5-(2-fluorophenyl)thiophen-2-yl]-3H-benzimidazol-5-yl]-2-hydroxyethanone (PubChem CID 157232904) has the molecular formula C19H13FN2O2S and a molecular weight of 352.39 g/mol. Its IUPAC name is 1-[2-[5-(2-fluorophenyl)thiophen-2-yl]-3H-benzimidazol-5-yl]-2-hydroxyethanone.
| Compound Name | 1-[2-[5-(2-fluorophenyl)thiophen-2-yl]-3H-benzimidazol-5-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 157232904 |
| Molecular Formula | C19H13FN2O2S |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 1-[2-[5-(2-fluorophenyl)thiophen-2-yl]-3H-benzimidazol-5-yl]-2-hydroxyethanone |
| SMILES | O=C(CO)c1ccc2nc(-c3ccc(-c4ccccc4F)s3)[nH]c2c1 |
| InChI | InChI=1S/C19H13FN2O2S/c20-13-4-2-1-3-12(13)17-7-8-18(25-17)19-21-14-6-5-11(16(24)10-23)9-15(14)22-19/h1-9,23H,10H2,(H,21,22) |
| InChIKey | AUHOWMBVHWQIML-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |