C16H10F4N2O2 — CID 158420839
1-[2-[2-fluoro-4-(trifluoromethyl)phenyl]-3H-benzimidazol-5-yl]-2-hydroxyethanone (PubChem CID 158420839) has the molecular formula C16H10F4N2O2 and a molecular weight of 338.26 g/mol. Its IUPAC name is 1-[2-[2-fluoro-4-(trifluoromethyl)phenyl]-3H-benzimidazol-5-yl]-2-hydroxyethanone.
| Compound Name | 1-[2-[2-fluoro-4-(trifluoromethyl)phenyl]-3H-benzimidazol-5-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 158420839 |
| Molecular Formula | C16H10F4N2O2 |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 1-[2-[2-fluoro-4-(trifluoromethyl)phenyl]-3H-benzimidazol-5-yl]-2-hydroxyethanone |
| SMILES | O=C(CO)c1ccc2nc(-c3ccc(C(F)(F)F)cc3F)[nH]c2c1 |
| InChI | InChI=1S/C16H10F4N2O2/c17-11-6-9(16(18,19)20)2-3-10(11)15-21-12-4-1-8(14(24)7-23)5-13(12)22-15/h1-6,23H,7H2,(H,21,22) |
| InChIKey | HALXEACDZOOZJE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |