C17H17FN4 — CID 4915580
2-(4-fluorophenyl)-N'-propan-2-yl-3H-benzimidazole-5-carboximidamide (PubChem CID 4915580) has the molecular formula C17H17FN4 and a molecular weight of 296.35 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N'-propan-2-yl-3H-benzimidazole-5-carboximidamide.
| Compound Name | 2-(4-fluorophenyl)-N'-propan-2-yl-3H-benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 4915580 |
| Molecular Formula | C17H17FN4 |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-(4-fluorophenyl)-N'-propan-2-yl-3H-benzimidazole-5-carboximidamide |
| SMILES | CC(C)/N=C(\N)c1ccc2nc(-c3ccc(F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C17H17FN4/c1-10(2)20-16(19)12-5-8-14-15(9-12)22-17(21-14)11-3-6-13(18)7-4-11/h3-10H,1-2H3,(H2,19,20)(H,21,22) |
| InChIKey | PFPGACOAGYKYNN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|