C39H43N7O — CID 165062251
N'-pentan-3-yl-2-[4-[4-[6-[1-(pentan-3-ylamino)ethenyl]-1H-benzimidazol-2-yl]phenoxy]phenyl]-3H-benzimidazole-5-carboximidamide (PubChem CID 165062251) has the molecular formula C39H43N7O and a molecular weight of 625.82 g/mol. Its IUPAC name is N'-pentan-3-yl-2-[4-[4-[6-[1-(pentan-3-ylamino)ethenyl]-1H-benzimidazol-2-yl]phenoxy]phenyl]-3H-benzimidazole-5-carboximidamide.
| Compound Name | N'-pentan-3-yl-2-[4-[4-[6-[1-(pentan-3-ylamino)ethenyl]-1H-benzimidazol-2-yl]phenoxy]phenyl]-3H-benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 165062251 |
| Molecular Formula | C39H43N7O |
| Molecular Weight | 625.82 g/mol |
| Exact Mass | 625.35 |
| IUPAC Name | N'-pentan-3-yl-2-[4-[4-[6-[1-(pentan-3-ylamino)ethenyl]-1H-benzimidazol-2-yl]phenoxy]phenyl]-3H-benzimidazole-5-carboximidamide |
| SMILES | C=C(NC(CC)CC)c1ccc2nc(-c3ccc(Oc4ccc(-c5nc6ccc(/C(N)=N/C(CC)CC)cc6[nH]5)cc4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C39H43N7O/c1-6-29(7-2)41-24(5)27-14-20-33-35(22-27)45-38(43-33)25-10-16-31(17-11-25)47-32-18-12-26(13-19-32)39-44-34-21-15-28(23-36(34)46-39)37(40)42-30(8-3)9-4/h10-23,29-30,41H,5-9H2,1-4H3,(H2,40,42)(H,43,45)(H,44,46) |
| InChIKey | CCKFIUDZCOYSLA-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.82 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|