C25H25FN4 — CID 3007950
2-[4-[2-(4-fluorophenyl)ethyl]phenyl]-N'-propan-2-yl-3H-benzimidazole-5-carboximidamide (PubChem CID 3007950) has the molecular formula C25H25FN4 and a molecular weight of 400.50 g/mol. Its IUPAC name is 2-[4-[2-(4-fluorophenyl)ethyl]phenyl]-N'-propan-2-yl-3H-benzimidazole-5-carboximidamide.
| Compound Name | 2-[4-[2-(4-fluorophenyl)ethyl]phenyl]-N'-propan-2-yl-3H-benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 3007950 |
| Molecular Formula | C25H25FN4 |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 2-[4-[2-(4-fluorophenyl)ethyl]phenyl]-N'-propan-2-yl-3H-benzimidazole-5-carboximidamide |
| SMILES | CC(C)/N=C(\N)c1ccc2nc(-c3ccc(CCc4ccc(F)cc4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C25H25FN4/c1-16(2)28-24(27)20-11-14-22-23(15-20)30-25(29-22)19-9-5-17(6-10-19)3-4-18-7-12-21(26)13-8-18/h5-16H,3-4H2,1-2H3,(H2,27,28)(H,29,30) |
| InChIKey | VPDWNCTXEOLQCM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|