C17H11N3S — CID 134164829
5-(2-phenyl-4-pyridinyl)-2,1,3-benzothiadiazole (PubChem CID 134164829) has the molecular formula C17H11N3S and a molecular weight of 289.36 g/mol. Its IUPAC name is 5-(2-phenyl-4-pyridinyl)-2,1,3-benzothiadiazole.
| Compound Name | 5-(2-phenyl-4-pyridinyl)-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 134164829 |
| Molecular Formula | C17H11N3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 5-(2-phenyl-4-pyridinyl)-2,1,3-benzothiadiazole |
| SMILES | c1ccc(-c2cc(-c3ccc4nsnc4c3)ccn2)cc1 |
| InChI | InChI=1S/C17H11N3S/c1-2-4-12(5-3-1)16-10-14(8-9-18-16)13-6-7-15-17(11-13)20-21-19-15/h1-11H |
| InChIKey | NDWZLBHYLWDVLX-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |