C40H34BBrN6O2S2 — CID 157076612
5-bromo-2,1,3-benzothiadiazole;5-(2-phenyl-4-pyridinyl)-2,1,3-benzothiadiazole;2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 157076612) has the molecular formula C40H34BBrN6O2S2 and a molecular weight of 785.60 g/mol. Its IUPAC name is 5-bromo-2,1,3-benzothiadiazole;5-(2-phenyl-4-pyridinyl)-2,1,3-benzothiadiazole;2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 5-bromo-2,1,3-benzothiadiazole;5-(2-phenyl-4-pyridinyl)-2,1,3-benzothiadiazole;2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 157076612 |
| Molecular Formula | C40H34BBrN6O2S2 |
| Molecular Weight | 785.60 g/mol |
| Exact Mass | 784.15 |
| IUPAC Name | 5-bromo-2,1,3-benzothiadiazole;5-(2-phenyl-4-pyridinyl)-2,1,3-benzothiadiazole;2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | Brc1ccc2nsnc2c1.CC1(C)OB(c2ccnc(-c3ccccc3)c2)OC1(C)C.c1ccc(-c2cc(-c3ccc4nsnc4c3)ccn2)cc1 |
| InChI | InChI=1S/C17H20BNO2.C17H11N3S.C6H3BrN2S/c1-16(2)17(3,4)21-18(20-16)14-10-11-19-15(12-14)13-8-6-5-7-9-13;1-2-4-12(5-3-1)16-10-14(8-9-18-16)13-6-7-15-17(11-13)20-21-19-15;7-4-1-2-5-6(3-4)9-10-8-5/h5-12H,1-4H3;1-11H;1-3H |
| InChIKey | ADAUFEDMLUHNSG-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 95.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.60 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|